C10H17N — CID 143172694
ethane;N-[(1E,3E)-2-ethenylpenta-1,3-dienyl]methanimine (PubChem CID 143172694) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;N-[(1E,3E)-2-ethenylpenta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1E,3E)-2-ethenylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143172694 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethane;N-[(1E,3E)-2-ethenylpenta-1,3-dienyl]methanimine |
| SMILES | C=CC(/C=C/C)=C\N=C.CC |
| InChI | InChI=1S/C8H11N.C2H6/c1-4-6-8(5-2)7-9-3;1-2/h4-7H,2-3H2,1H3;1-2H3/b6-4+,8-7+; |
| InChIKey | SVFGRRXMOPUCLC-OOTSTRPFSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|