C25H23ClO3S — CID 143173213
2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143173213) has the molecular formula C25H23ClO3S and a molecular weight of 438.98 g/mol. Its IUPAC name is 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143173213 |
| Molecular Formula | C25H23ClO3S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | OCC1CC(O)CC(c2cc(Cc3cc4cc(Cl)ccc4s3)cc3ccccc23)O1 |
| InChI | InChI=1S/C25H23ClO3S/c26-18-5-6-25-17(10-18)11-21(30-25)8-15-7-16-3-1-2-4-22(16)23(9-15)24-13-19(28)12-20(14-27)29-24/h1-7,9-11,19-20,24,27-28H,8,12-14H2 |
| InChIKey | DRJKEYVABHRWBV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |