C20H18Cl2N4O — CID 143178391
(2S)-2-amino-N-(3,5-dichlorophenyl)-4-(4-pyrimidin-5-ylphenyl)butanamide (PubChem CID 143178391) has the molecular formula C20H18Cl2N4O and a molecular weight of 401.30 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,5-dichlorophenyl)-4-(4-pyrimidin-5-ylphenyl)butanamide.
| Compound Name | (2S)-2-amino-N-(3,5-dichlorophenyl)-4-(4-pyrimidin-5-ylphenyl)butanamide |
|---|---|
| PubChem CID | 143178391 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (2S)-2-amino-N-(3,5-dichlorophenyl)-4-(4-pyrimidin-5-ylphenyl)butanamide |
| SMILES | N[C@@H](CCc1ccc(-c2cncnc2)cc1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N4O/c21-16-7-17(22)9-18(8-16)26-20(27)19(23)6-3-13-1-4-14(5-2-13)15-10-24-12-25-11-15/h1-2,4-5,7-12,19H,3,6,23H2,(H,26,27)/t19-/m0/s1 |
| InChIKey | YZHSVDZMKGEQBD-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |