C25H25N5O3 — CID 143184893
ethyl N-[3-[3-cyano-6-(3-imidazol-1-ylpropoxy)-1-methylindol-2-yl]phenyl]carbamate (PubChem CID 143184893) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is ethyl N-[3-[3-cyano-6-(3-imidazol-1-ylpropoxy)-1-methylindol-2-yl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[3-cyano-6-(3-imidazol-1-ylpropoxy)-1-methylindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 143184893 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | ethyl N-[3-[3-cyano-6-(3-imidazol-1-ylpropoxy)-1-methylindol-2-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(-c2c(C#N)c3ccc(OCCCn4ccnc4)cc3n2C)c1 |
| InChI | InChI=1S/C25H25N5O3/c1-3-32-25(31)28-19-7-4-6-18(14-19)24-22(16-26)21-9-8-20(15-23(21)29(24)2)33-13-5-11-30-12-10-27-17-30/h4,6-10,12,14-15,17H,3,5,11,13H2,1-2H3,(H,28,31) |
| InChIKey | NGMDFYQDZVHZEQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|