C15H14Cl2N2O3 — CID 143190204
3-[1-(2,6-dichloro-3-methylphenyl)propoxy]-2-nitropyridine (PubChem CID 143190204) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-methylphenyl)propoxy]-2-nitropyridine.
| Compound Name | 3-[1-(2,6-dichloro-3-methylphenyl)propoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 143190204 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-methylphenyl)propoxy]-2-nitropyridine |
| SMILES | CCC(Oc1cccnc1[N+](=O)[O-])c1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-3-11(13-10(16)7-6-9(2)14(13)17)22-12-5-4-8-18-15(12)19(20)21/h4-8,11H,3H2,1-2H3 |
| InChIKey | BAPHQHSACBXACM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|