C13H9Cl2FN2O2S — CID 150989767
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]sulfanyl-2-nitropyridine (PubChem CID 150989767) has the molecular formula C13H9Cl2FN2O2S and a molecular weight of 347.20 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]sulfanyl-2-nitropyridine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]sulfanyl-2-nitropyridine |
|---|---|
| PubChem CID | 150989767 |
| Molecular Formula | C13H9Cl2FN2O2S |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]sulfanyl-2-nitropyridine |
| SMILES | C[C@@H](Sc1cccnc1[N+](=O)[O-])c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O2S/c1-7(11-8(14)4-5-9(16)12(11)15)21-10-3-2-6-17-13(10)18(19)20/h2-7H,1H3/t7-/m1/s1 |
| InChIKey | LRWHJENUFKBIAN-SSDOTTSWSA-N |
| XLogP | 5.29 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|