C30H36ClFN6O2 — CID 143194811
N-[5-[N-(3-chloro-4-fluorophenyl)-N'-methylcarbamimidoyl]-2-[3-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylbut-1-ynyl]-4-(methylideneamino)phenyl]prop-2-enamide (PubChem CID 143194811) has the molecular formula C30H36ClFN6O2 and a molecular weight of 567.11 g/mol. Its IUPAC name is N-[5-[N-(3-chloro-4-fluorophenyl)-N'-methylcarbamimidoyl]-2-[3-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylbut-1-ynyl]-4-(methylideneamino)phenyl]prop-2-enamide.
| Compound Name | N-[5-[N-(3-chloro-4-fluorophenyl)-N'-methylcarbamimidoyl]-2-[3-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylbut-1-ynyl]-4-(methylideneamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143194811 |
| Molecular Formula | C30H36ClFN6O2 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | N-[5-[N-(3-chloro-4-fluorophenyl)-N'-methylcarbamimidoyl]-2-[3-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylbut-1-ynyl]-4-(methylideneamino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(/C(=N/C)Nc2ccc(F)c(Cl)c2)c(N=C)cc1C#CC(C)(C)N1CCN(CCOC)CC1 |
| InChI | InChI=1S/C30H36ClFN6O2/c1-7-28(39)36-26-20-23(29(34-5)35-22-8-9-25(32)24(31)19-22)27(33-4)18-21(26)10-11-30(2,3)38-14-12-37(13-15-38)16-17-40-6/h7-9,18-20H,1,4,12-17H2,2-3,5-6H3,(H,34,35)(H,36,39) |
| InChIKey | UYGDAXXBTRDNSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|