C20H21Cl2N7O3S2 — CID 143197194
2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl N-[amino-[(E)-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]amino]methylidene]carbamate (PubChem CID 143197194) has the molecular formula C20H21Cl2N7O3S2 and a molecular weight of 542.47 g/mol. Its IUPAC name is 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl N-[amino-[(E)-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]amino]methylidene]carbamate.
| Compound Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl N-[amino-[(E)-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 143197194 |
| Molecular Formula | C20H21Cl2N7O3S2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl N-[amino-[(E)-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]amino]methylidene]carbamate |
| SMILES | [H]/N=C(C(/N)=N\C(N)=NC(=O)OCCSSCCNC(=O)c1cccnc1)\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl2N7O3S2/c21-14-5-1-4-13(15(14)22)16(23)17(24)28-19(25)29-20(31)32-8-10-34-33-9-7-27-18(30)12-3-2-6-26-11-12/h1-6,11,23H,7-10H2,(H,27,30)(H4,24,25,28,29,31)/b23-16+ |
| InChIKey | ARVJHRGERQTEKA-XQNSMLJCSA-N |
| XLogP | 3.38 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|