C20H19Cl2N7O3S2 — CID 54588644
2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl 5-amino-6-(2,3-dichlorophenyl)-3-imino-1,2,4-triazine-2-carboxylate (PubChem CID 54588644) has the molecular formula C20H19Cl2N7O3S2 and a molecular weight of 540.46 g/mol. Its IUPAC name is 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl 5-amino-6-(2,3-dichlorophenyl)-3-imino-1,2,4-triazine-2-carboxylate.
| Compound Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl 5-amino-6-(2,3-dichlorophenyl)-3-imino-1,2,4-triazine-2-carboxylate |
|---|---|
| PubChem CID | 54588644 |
| Molecular Formula | C20H19Cl2N7O3S2 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl 5-amino-6-(2,3-dichlorophenyl)-3-imino-1,2,4-triazine-2-carboxylate |
| SMILES | [H]/N=c1\nc(N)c(-c2cccc(Cl)c2Cl)nn1C(=O)OCCSSCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H19Cl2N7O3S2/c21-14-5-1-4-13(15(14)22)16-17(23)27-19(24)29(28-16)20(31)32-8-10-34-33-9-7-26-18(30)12-3-2-6-25-11-12/h1-6,11H,7-10H2,(H,26,30)(H3,23,24,27) |
| InChIKey | FAOYFGAGFLIZBU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|