C15H16N2O7 — CID 14319840
5-[ethoxy-(4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 14319840) has the molecular formula C15H16N2O7 and a molecular weight of 336.30 g/mol. Its IUPAC name is 5-[ethoxy-(4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[ethoxy-(4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14319840 |
| Molecular Formula | C15H16N2O7 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-[ethoxy-(4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOC(Nc1ccc([N+](=O)[O-])cc1)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C15H16N2O7/c1-4-22-12(11-13(18)23-15(2,3)24-14(11)19)16-9-5-7-10(8-6-9)17(20)21/h5-8,16H,4H2,1-3H3 |
| InChIKey | SEGRQZMGDZKMGX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|