C16H22N4O2S2 — CID 143199199
N-(2-phenyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-6-[(2-sulfanylacetyl)amino]hexanamide (PubChem CID 143199199) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-(2-phenyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-6-[(2-sulfanylacetyl)amino]hexanamide.
| Compound Name | N-(2-phenyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-6-[(2-sulfanylacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 143199199 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2-phenyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-6-[(2-sulfanylacetyl)amino]hexanamide |
| SMILES | O=C(CS)NCCCCCC(=O)NC1=NNC(c2ccccc2)S1 |
| InChI | InChI=1S/C16H22N4O2S2/c21-13(9-5-2-6-10-17-14(22)11-23)18-16-20-19-15(24-16)12-7-3-1-4-8-12/h1,3-4,7-8,15,19,23H,2,5-6,9-11H2,(H,17,22)(H,18,20,21) |
| InChIKey | GRHHSPSRQBKPLO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|