C31H36F8N2O2S — CID 143200766
acetylene;2-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide;4-[(3S)-3-(2,4-difluorophenyl)piperidin-1-yl]thiane 1-oxide (PubChem CID 143200766) has the molecular formula C31H36F8N2O2S and a molecular weight of 652.69 g/mol. Its IUPAC name is acetylene;2-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide;4-[(3S)-3-(2,4-difluorophenyl)piperidin-1-yl]thiane 1-oxide.
| Compound Name | acetylene;2-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide;4-[(3S)-3-(2,4-difluorophenyl)piperidin-1-yl]thiane 1-oxide |
|---|---|
| PubChem CID | 143200766 |
| Molecular Formula | C31H36F8N2O2S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | acetylene;2-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide;4-[(3S)-3-(2,4-difluorophenyl)piperidin-1-yl]thiane 1-oxide |
| SMILES | C#C.CNC(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=S1CCC(N2CCC[C@@H](c3ccc(F)cc3F)C2)CC1 |
| InChI | InChI=1S/C16H21F2NOS.C13H13F6NO.C2H2/c17-13-3-4-15(16(18)10-13)12-2-1-7-19(11-12)14-5-8-21(20)9-6-14;1-11(2,10(21)20-3)7-4-8(12(14,15)16)6-9(5-7)13(17,18)19;1-2/h3-4,10,12,14H,1-2,5-9,11H2;4-6H,1-3H3,(H,20,21);1-2H/t12-,14?,21?;;/m1../s1 |
| InChIKey | GDRUZOVPMWFGNS-PRNDRPRMSA-N |
| XLogP | 7.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|