C11H19NO — CID 143202552
N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2,2-dimethylpropanamide (PubChem CID 143202552) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 143202552 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2,2-dimethylpropanamide |
| SMILES | C/C=C\C(=C/C)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-8-9(7-2)12-10(13)11(3,4)5/h6-8H,1-5H3,(H,12,13)/b8-6-,9-7+ |
| InChIKey | KIJIUFVPVDADOH-MKKAVFGOSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|