C14H29N — CID 143202821
ethane;(4Z)-4-ethyl-5-methylhepta-4,6-dien-3-imine (PubChem CID 143202821) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(4Z)-4-ethyl-5-methylhepta-4,6-dien-3-imine.
| Compound Name | ethane;(4Z)-4-ethyl-5-methylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 143202821 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(4Z)-4-ethyl-5-methylhepta-4,6-dien-3-imine |
| SMILES | CC.CC.[H]/N=C(CC)/C(CC)=C(/C)C=C |
| InChI | InChI=1S/C10H17N.2C2H6/c1-5-8(4)9(6-2)10(11)7-3;2*1-2/h5,11H,1,6-7H2,2-4H3;2*1-2H3/b9-8-,11-10+;; |
| InChIKey | CIZAAKKQZXBGHC-QGPNDUNESA-N |
| XLogP | 5.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|