C21H30N2 — CID 143208795
2-cyclohexa-1,5-dien-1-yl-2-[[(3E,5Z)-3,5-di(propan-2-yl)hepta-1,3,5-trien-4-yl]amino]acetonitrile (PubChem CID 143208795) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-[[(3E,5Z)-3,5-di(propan-2-yl)hepta-1,3,5-trien-4-yl]amino]acetonitrile.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2-[[(3E,5Z)-3,5-di(propan-2-yl)hepta-1,3,5-trien-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 143208795 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2-[[(3E,5Z)-3,5-di(propan-2-yl)hepta-1,3,5-trien-4-yl]amino]acetonitrile |
| SMILES | C=C/C(=C(NC(C#N)C1=CCCC=C1)\C(=C/C)C(C)C)C(C)C |
| InChI | InChI=1S/C21H30N2/c1-7-18(15(3)4)21(19(8-2)16(5)6)23-20(14-22)17-12-10-9-11-13-17/h7-8,10,12-13,15-16,20,23H,1,9,11H2,2-6H3/b19-8-,21-18- |
| InChIKey | FBUMVXYTWKQLNR-RANVQQCNSA-N |
| XLogP | 5.44 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|