C17H25N — CID 118247092
6-methyl-N-[(3Z)-5-methyl-6-methylideneocta-3,7-dien-2-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 118247092) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-methyl-N-[(3Z)-5-methyl-6-methylideneocta-3,7-dien-2-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 6-methyl-N-[(3Z)-5-methyl-6-methylideneocta-3,7-dien-2-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 118247092 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-methyl-N-[(3Z)-5-methyl-6-methylideneocta-3,7-dien-2-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | C=CC(=C)C(C)/C=C\C(C)NC1=CC=CCC1C |
| InChI | InChI=1S/C17H25N/c1-6-13(2)14(3)11-12-16(5)18-17-10-8-7-9-15(17)4/h6-8,10-12,14-16,18H,1-2,9H2,3-5H3/b12-11- |
| InChIKey | SHFKUDINIJAYOI-QXMHVHEDSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|