C16H27N — CID 126510164
2-methyl-3-methylidene-N-propan-2-yl-5-prop-2-enylocta-4,7-dien-4-amine (PubChem CID 126510164) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-methyl-3-methylidene-N-propan-2-yl-5-prop-2-enylocta-4,7-dien-4-amine.
| Compound Name | 2-methyl-3-methylidene-N-propan-2-yl-5-prop-2-enylocta-4,7-dien-4-amine |
|---|---|
| PubChem CID | 126510164 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-methyl-3-methylidene-N-propan-2-yl-5-prop-2-enylocta-4,7-dien-4-amine |
| SMILES | C=CCC(CC=C)=C(NC(C)C)C(=C)C(C)C |
| InChI | InChI=1S/C16H27N/c1-8-10-15(11-9-2)16(17-13(5)6)14(7)12(3)4/h8-9,12-13,17H,1-2,7,10-11H2,3-6H3 |
| InChIKey | VELQFZXJHJGYMC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|