C22H18ClN3O3 — CID 143212465
(2R)-3-(6-chloro-1H-benzimidazol-2-yl)-2-[(2-naphthalen-1-ylacetyl)amino]propanoic acid (PubChem CID 143212465) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is (2R)-3-(6-chloro-1H-benzimidazol-2-yl)-2-[(2-naphthalen-1-ylacetyl)amino]propanoic acid.
| Compound Name | (2R)-3-(6-chloro-1H-benzimidazol-2-yl)-2-[(2-naphthalen-1-ylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 143212465 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (2R)-3-(6-chloro-1H-benzimidazol-2-yl)-2-[(2-naphthalen-1-ylacetyl)amino]propanoic acid |
| SMILES | O=C(Cc1cccc2ccccc12)N[C@H](Cc1nc2ccc(Cl)cc2[nH]1)C(=O)O |
| InChI | InChI=1S/C22H18ClN3O3/c23-15-8-9-17-18(11-15)25-20(24-17)12-19(22(28)29)26-21(27)10-14-6-3-5-13-4-1-2-7-16(13)14/h1-9,11,19H,10,12H2,(H,24,25)(H,26,27)(H,28,29)/t19-/m1/s1 |
| InChIKey | VYZTTXWZAVEGJF-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |