C13H21N — CID 143213492
ethane;N-[(4E)-7-methyl-3-methylideneocta-1,4,6-trien-4-yl]methanimine (PubChem CID 143213492) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;N-[(4E)-7-methyl-3-methylideneocta-1,4,6-trien-4-yl]methanimine.
| Compound Name | ethane;N-[(4E)-7-methyl-3-methylideneocta-1,4,6-trien-4-yl]methanimine |
|---|---|
| PubChem CID | 143213492 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;N-[(4E)-7-methyl-3-methylideneocta-1,4,6-trien-4-yl]methanimine |
| SMILES | C=CC(=C)C(=CC=C(C)C)N=C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-6-10(4)11(12-5)8-7-9(2)3;1-2/h6-8H,1,4-5H2,2-3H3;1-2H3/b11-8+; |
| InChIKey | PDHOAVVISOASLJ-YGCVIUNWSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|