C16H21N — CID 143215928
N-(4-butylcyclohexa-1,3-dien-1-yl)aniline (PubChem CID 143215928) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-(4-butylcyclohexa-1,3-dien-1-yl)aniline.
| Compound Name | N-(4-butylcyclohexa-1,3-dien-1-yl)aniline |
|---|---|
| PubChem CID | 143215928 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-(4-butylcyclohexa-1,3-dien-1-yl)aniline |
| SMILES | CCCCC1=CC=C(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N/c1-2-3-7-14-10-12-16(13-11-14)17-15-8-5-4-6-9-15/h4-6,8-10,12,17H,2-3,7,11,13H2,1H3 |
| InChIKey | YGMGZCDTEIFRRH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |