C9H12N2 — CID 143224183
(Z)-2-(5-methyl-4H-azepin-6-yl)ethenamine (PubChem CID 143224183) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (Z)-2-(5-methyl-4H-azepin-6-yl)ethenamine.
| Compound Name | (Z)-2-(5-methyl-4H-azepin-6-yl)ethenamine |
|---|---|
| PubChem CID | 143224183 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (Z)-2-(5-methyl-4H-azepin-6-yl)ethenamine |
| SMILES | CC1=C(/C=C\N)C=NC=CC1 |
| InChI | InChI=1S/C9H12N2/c1-8-3-2-6-11-7-9(8)4-5-10/h2,4-7H,3,10H2,1H3/b5-4- |
| InChIKey | VWJFZYQZMKGSSB-PLNGDYQASA-N |
| XLogP | 1.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |