C15H12O — CID 143232247
11-methyl-9-oxatricyclo[8.5.0.02,8]pentadeca-1(10),2,3,5,7,11,14-heptaene (PubChem CID 143232247) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is 11-methyl-9-oxatricyclo[8.5.0.02,8]pentadeca-1(10),2,3,5,7,11,14-heptaene.
| Compound Name | 11-methyl-9-oxatricyclo[8.5.0.02,8]pentadeca-1(10),2,3,5,7,11,14-heptaene |
|---|---|
| PubChem CID | 143232247 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 11-methyl-9-oxatricyclo[8.5.0.02,8]pentadeca-1(10),2,3,5,7,11,14-heptaene |
| SMILES | CC1=CCC=Cc2c1oc1c2=C=CC=CC=1 |
| InChI | InChI=1S/C15H12O/c1-11-7-5-6-9-13-12-8-3-2-4-10-14(12)16-15(11)13/h2-4,6-7,9-10H,5H2,1H3 |
| InChIKey | XNYOPASOQRUEKJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |