C23H36 — CID 143236819
(7Z)-3-ethyl-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene (PubChem CID 143236819) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is (7Z)-3-ethyl-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene.
| Compound Name | (7Z)-3-ethyl-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 143236819 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (7Z)-3-ethyl-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene |
| SMILES | C=C/C=C1/CCC2C(=CCC3(C)C(CC)CCC23)C1(C)CCC |
| InChI | InChI=1S/C23H36/c1-6-9-18-10-12-19-20-13-11-17(8-3)23(20,5)16-14-21(19)22(18,4)15-7-2/h6,9,14,17,19-20H,1,7-8,10-13,15-16H2,2-5H3/b18-9- |
| InChIKey | OMORWFAVBOTQIP-NVMNQCDNSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|