C31H54 — CID 143113717
(7Z,9R)-3a,6,9-trimethyl-3-(2-methylidenebutyl)-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene;ethane (PubChem CID 143113717) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is (7Z,9R)-3a,6,9-trimethyl-3-(2-methylidenebutyl)-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene;ethane.
| Compound Name | (7Z,9R)-3a,6,9-trimethyl-3-(2-methylidenebutyl)-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene;ethane |
|---|---|
| PubChem CID | 143113717 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | (7Z,9R)-3a,6,9-trimethyl-3-(2-methylidenebutyl)-7-prop-2-enylidene-6-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalene;ethane |
| SMILES | C=C/C=C1/C[C@@H](C)C2C(=CCC3(C)C(CC(=C)CC)CCC23)C1(C)CCC.CC.CC |
| InChI | InChI=1S/C27H42.2C2H6/c1-8-11-21-18-20(5)25-23-13-12-22(17-19(4)10-3)27(23,7)16-14-24(25)26(21,6)15-9-2;2*1-2/h8,11,14,20,22-23,25H,1,4,9-10,12-13,15-18H2,2-3,5-7H3;2*1-2H3/b21-11-;;/t20-,22?,23?,25?,26?,27?;;/m1../s1 |
| InChIKey | DXGTYCLNUZFDAQ-SIFHHQFYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|