C19H20N2O2S — CID 143238478
(Z)-but-2-ene;3-phenyl-5-prop-2-enyl-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 143238478) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (Z)-but-2-ene;3-phenyl-5-prop-2-enyl-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (Z)-but-2-ene;3-phenyl-5-prop-2-enyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143238478 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (Z)-but-2-ene;3-phenyl-5-prop-2-enyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | C/C=C\C.C=CCc1csc2[nH]c(=O)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C15H12N2O2S.C4H8/c1-2-6-10-9-20-13-12(10)14(18)17(15(19)16-13)11-7-4-3-5-8-11;1-3-4-2/h2-5,7-9H,1,6H2,(H,16,19);3-4H,1-2H3/b;4-3- |
| InChIKey | ICRCKYDQZGVVNM-QGAMPUOQSA-N |
| XLogP | 4.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|