C17H31NO6 — CID 143241191
cis-(5S,9R,10E)-7,12,13-trihydroxy-10-hydroxyimino-3,5,9,11-tetramethyl-oxacyclotetradecan-2-one (PubChem CID 143241191) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is cis-(5S,9R,10E)-7,12,13-trihydroxy-10-hydroxyimino-3,5,9,11-tetramethyl-oxacyclotetradecan-2-one.
| Compound Name | cis-(5S,9R,10E)-7,12,13-trihydroxy-10-hydroxyimino-3,5,9,11-tetramethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 143241191 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | cis-(5S,9R,10E)-7,12,13-trihydroxy-10-hydroxyimino-3,5,9,11-tetramethyl-oxacyclotetradecan-2-one |
| SMILES | CC1C[C@H](C)CC(O)C[C@@H](C)/C(=N\O)C(C)C(O)C(O)COC1=O |
| InChI | InChI=1S/C17H31NO6/c1-9-5-11(3)17(22)24-8-14(20)16(21)12(4)15(18-23)10(2)7-13(19)6-9/h9-14,16,19-21,23H,5-8H2,1-4H3/b18-15+/t9-,10+,11?,12?,13?,14?,16?/m0/s1 |
| InChIKey | GAYAUNYUBUJDNM-DIIRTTACSA-N |
| XLogP | 1.17 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|