C18H35NO5 — CID 139311406
(3R,4R,5R,10S,12S,14R)-3,4-dihydroxy-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 139311406) has the molecular formula C18H35NO5 and a molecular weight of 345.48 g/mol. Its IUPAC name is (3R,4R,5R,10S,12S,14R)-3,4-dihydroxy-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (3R,4R,5R,10S,12S,14R)-3,4-dihydroxy-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 139311406 |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (3R,4R,5R,10S,12S,14R)-3,4-dihydroxy-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CO[C@H]1CCCN(C)[C@H](C)[C@@H](O)[C@H](O)COC(=O)[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C18H35NO5/c1-12-9-13(2)18(22)24-11-16(20)17(21)14(3)19(4)8-6-7-15(10-12)23-5/h12-17,20-21H,6-11H2,1-5H3/t12-,13+,14+,15-,16+,17+/m0/s1 |
| InChIKey | GCGDVOQFVABRJF-JXMXSTLTSA-N |
| XLogP | 1.43 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |