C25H47NO8 — CID 139311403
(3R,4R,5R,10S,11R,12S,13S,14R)-3,4,11-trihydroxy-13-[(4S,5R,6S)-5-hydroxy-4,6-dimethyloxan-2-yl]-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 139311403) has the molecular formula C25H47NO8 and a molecular weight of 489.65 g/mol. Its IUPAC name is (3R,4R,5R,10S,11R,12S,13S,14R)-3,4,11-trihydroxy-13-[(4S,5R,6S)-5-hydroxy-4,6-dimethyloxan-2-yl]-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (3R,4R,5R,10S,11R,12S,13S,14R)-3,4,11-trihydroxy-13-[(4S,5R,6S)-5-hydroxy-4,6-dimethyloxan-2-yl]-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 139311403 |
| Molecular Formula | C25H47NO8 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | (3R,4R,5R,10S,11R,12S,13S,14R)-3,4,11-trihydroxy-13-[(4S,5R,6S)-5-hydroxy-4,6-dimethyloxan-2-yl]-10-methoxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CO[C@H]1CCCN(C)[C@H](C)[C@@H](O)[C@H](O)COC(=O)[C@H](C)[C@@H](C2C[C@H](C)[C@@H](O)[C@H](C)O2)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C25H47NO8/c1-13-11-20(34-17(5)22(13)28)21-14(2)23(29)19(32-7)9-8-10-26(6)16(4)24(30)18(27)12-33-25(31)15(21)3/h13-24,27-30H,8-12H2,1-7H3/t13-,14-,15+,16+,17-,18+,19-,20?,21-,22+,23+,24+/m0/s1 |
| InChIKey | JPNUBJNLTNMZSY-YQYJLDJDSA-N |
| XLogP | 0.80 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |