C28H42N2O8 — CID 6419645
(4E,6R,7S,11S,18E,20R,21S,25S)-7,21-dimethoxy-6,20-dimethyl-9,23-dioxa-1,15-diazatricyclo[23.3.0.011,15]octacosa-4,18-diene-2,10,16,24-tetrone (PubChem CID 6419645) has the molecular formula C28H42N2O8 and a molecular weight of 534.65 g/mol. Its IUPAC name is (4E,6R,7S,11S,18E,20R,21S,25S)-7,21-dimethoxy-6,20-dimethyl-9,23-dioxa-1,15-diazatricyclo[23.3.0.011,15]octacosa-4,18-diene-2,10,16,24-tetrone.
| Compound Name | (4E,6R,7S,11S,18E,20R,21S,25S)-7,21-dimethoxy-6,20-dimethyl-9,23-dioxa-1,15-diazatricyclo[23.3.0.011,15]octacosa-4,18-diene-2,10,16,24-tetrone |
|---|---|
| PubChem CID | 6419645 |
| Molecular Formula | C28H42N2O8 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | (4E,6R,7S,11S,18E,20R,21S,25S)-7,21-dimethoxy-6,20-dimethyl-9,23-dioxa-1,15-diazatricyclo[23.3.0.011,15]octacosa-4,18-diene-2,10,16,24-tetrone |
| SMILES | CO[C@@H]1COC(=O)[C@@H]2CCCN2C(=O)C/C=C/[C@@H](C)[C@H](OC)COC(=O)[C@@H]2CCCN2C(=O)C/C=C/[C@H]1C |
| InChI | InChI=1S/C28H42N2O8/c1-19-9-5-13-25(31)29-15-8-12-22(29)28(34)38-18-24(36-4)20(2)10-6-14-26(32)30-16-7-11-21(30)27(33)37-17-23(19)35-3/h5-6,9-10,19-24H,7-8,11-18H2,1-4H3/b9-5+,10-6+/t19-,20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | KNMMSRXSBJUKBY-MTRKSTBGSA-N |
| XLogP | 2.26 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|