C16H18FNO2 — CID 143262000
methyl N-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]phenyl]methyl]carbamate (PubChem CID 143262000) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is methyl N-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 143262000 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | methyl N-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]phenyl]methyl]carbamate |
| SMILES | C=C/C(=C\C(F)=C/C)c1ccc(CNC(=O)OC)cc1 |
| InChI | InChI=1S/C16H18FNO2/c1-4-13(10-15(17)5-2)14-8-6-12(7-9-14)11-18-16(19)20-3/h4-10H,1,11H2,2-3H3,(H,18,19)/b13-10+,15-5+ |
| InChIKey | BXRKGVULXFBWAQ-LSYLLSSQSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|