C35H39N7O7 — CID 143266323
[5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]-1,3-dihydrotetrazol-2-yl]methyl [3-(nitrooxymethyl)phenyl]methyl carbonate (PubChem CID 143266323) has the molecular formula C35H39N7O7 and a molecular weight of 669.74 g/mol. Its IUPAC name is [5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]-1,3-dihydrotetrazol-2-yl]methyl [3-(nitrooxymethyl)phenyl]methyl carbonate.
| Compound Name | [5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]-1,3-dihydrotetrazol-2-yl]methyl [3-(nitrooxymethyl)phenyl]methyl carbonate |
|---|---|
| PubChem CID | 143266323 |
| Molecular Formula | C35H39N7O7 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | [5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]-1,3-dihydrotetrazol-2-yl]methyl [3-(nitrooxymethyl)phenyl]methyl carbonate |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2C2=NNN(COC(=O)OCc3cccc(CO[N+](=O)[O-])c3)N2)cc1 |
| InChI | InChI=1S/C35H39N7O7/c1-2-3-13-31-36-35(18-6-7-19-35)33(43)40(31)21-25-14-16-28(17-15-25)29-11-4-5-12-30(29)32-37-39-41(38-32)24-48-34(44)47-22-26-9-8-10-27(20-26)23-49-42(45)46/h4-5,8-12,14-17,20,39H,2-3,6-7,13,18-19,21-24H2,1H3,(H,37,38) |
| InChIKey | DEDXWIDBGUZIIC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 160.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|