C10H18OS — CID 143267515
(6Z)-6-methylsulfanylnona-6,8-dien-4-ol (PubChem CID 143267515) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (6Z)-6-methylsulfanylnona-6,8-dien-4-ol.
| Compound Name | (6Z)-6-methylsulfanylnona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 143267515 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (6Z)-6-methylsulfanylnona-6,8-dien-4-ol |
| SMILES | C=C/C=C(/CC(O)CCC)SC |
| InChI | InChI=1S/C10H18OS/c1-4-6-9(11)8-10(12-3)7-5-2/h5,7,9,11H,2,4,6,8H2,1,3H3/b10-7- |
| InChIKey | ZVJGYMGEGSDOSS-YFHOEESVSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|