C13H19F3O — CID 143267807
(6Z,7E)-6-ethylidene-7-(trifluoromethyl)deca-7,9-dien-4-ol (PubChem CID 143267807) has the molecular formula C13H19F3O and a molecular weight of 248.29 g/mol. Its IUPAC name is (6Z,7E)-6-ethylidene-7-(trifluoromethyl)deca-7,9-dien-4-ol.
| Compound Name | (6Z,7E)-6-ethylidene-7-(trifluoromethyl)deca-7,9-dien-4-ol |
|---|---|
| PubChem CID | 143267807 |
| Molecular Formula | C13H19F3O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (6Z,7E)-6-ethylidene-7-(trifluoromethyl)deca-7,9-dien-4-ol |
| SMILES | C=C/C=C(C(=C/C)\CC(O)CCC)/C(F)(F)F |
| InChI | InChI=1S/C13H19F3O/c1-4-7-11(17)9-10(6-3)12(8-5-2)13(14,15)16/h5-6,8,11,17H,2,4,7,9H2,1,3H3/b10-6-,12-8+ |
| InChIKey | QGNGUMIIIONIGL-MJONFVJTSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|