C30H42N4O2 — CID 143271947
ethane;1-[1-[2-(2-methoxy-5-piperidin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide (PubChem CID 143271947) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is ethane;1-[1-[2-(2-methoxy-5-piperidin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide.
| Compound Name | ethane;1-[1-[2-(2-methoxy-5-piperidin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
|---|---|
| PubChem CID | 143271947 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | ethane;1-[1-[2-(2-methoxy-5-piperidin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
| SMILES | CC.COc1ccc(N2CCCCC2)cc1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1 |
| InChI | InChI=1S/C28H36N4O2.C2H6/c1-34-27-8-7-25(31-13-3-2-4-14-31)19-22(27)9-15-30-16-11-24(12-17-30)32-18-10-21-5-6-23(28(29)33)20-26(21)32;1-2/h5-8,10,18-20,24H,2-4,9,11-17H2,1H3,(H2,29,33);1-2H3 |
| InChIKey | LDCKHEYASHMZII-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|