C25H29N3O3 — CID 59727875
1-[1-[2-(2-acetyl-6-methoxyphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide (PubChem CID 59727875) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[1-[2-(2-acetyl-6-methoxyphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide.
| Compound Name | 1-[1-[2-(2-acetyl-6-methoxyphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
|---|---|
| PubChem CID | 59727875 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[1-[2-(2-acetyl-6-methoxyphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
| SMILES | COc1cccc(C(C)=O)c1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(29)21-4-3-5-24(31-2)22(21)11-14-27-12-9-20(10-13-27)28-15-8-18-6-7-19(25(26)30)16-23(18)28/h3-8,15-16,20H,9-14H2,1-2H3,(H2,26,30) |
| InChIKey | AHKBNKOKQWMQQW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |