C30H33N3O3 — CID 59727851
1-[1-[2-[2-methoxy-6-(2-methoxyphenyl)phenyl]ethyl]piperidin-4-yl]indole-6-carboxamide (PubChem CID 59727851) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 1-[1-[2-[2-methoxy-6-(2-methoxyphenyl)phenyl]ethyl]piperidin-4-yl]indole-6-carboxamide.
| Compound Name | 1-[1-[2-[2-methoxy-6-(2-methoxyphenyl)phenyl]ethyl]piperidin-4-yl]indole-6-carboxamide |
|---|---|
| PubChem CID | 59727851 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 1-[1-[2-[2-methoxy-6-(2-methoxyphenyl)phenyl]ethyl]piperidin-4-yl]indole-6-carboxamide |
| SMILES | COc1ccccc1-c1cccc(OC)c1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1 |
| InChI | InChI=1S/C30H33N3O3/c1-35-28-8-4-3-6-25(28)24-7-5-9-29(36-2)26(24)15-18-32-16-13-23(14-17-32)33-19-12-21-10-11-22(30(31)34)20-27(21)33/h3-12,19-20,23H,13-18H2,1-2H3,(H2,31,34) |
| InChIKey | XRSJDUCLRWUDHW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |