C27H35N5O2 — CID 59727790
1-[1-[2-(2-methoxy-6-piperazin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide (PubChem CID 59727790) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-[1-[2-(2-methoxy-6-piperazin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide.
| Compound Name | 1-[1-[2-(2-methoxy-6-piperazin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
|---|---|
| PubChem CID | 59727790 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-[1-[2-(2-methoxy-6-piperazin-1-ylphenyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
| SMILES | COc1cccc(N2CCNCC2)c1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1 |
| InChI | InChI=1S/C27H35N5O2/c1-34-26-4-2-3-24(31-17-11-29-12-18-31)23(26)10-15-30-13-8-22(9-14-30)32-16-7-20-5-6-21(27(28)33)19-25(20)32/h2-7,16,19,22,29H,8-15,17-18H2,1H3,(H2,28,33) |
| InChIKey | ISPDYEBXDJZYAM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |