C15H18N2O2 — CID 143272714
3-amino-4-[5-[(1Z)-2-ethylbuta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 143272714) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-amino-4-[5-[(1Z)-2-ethylbuta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[5-[(1Z)-2-ethylbuta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 143272714 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-amino-4-[5-[(1Z)-2-ethylbuta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | C=C/C(=C\C1=C(C)CCN1c1c(N)c(=O)c1=O)CC |
| InChI | InChI=1S/C15H18N2O2/c1-4-10(5-2)8-11-9(3)6-7-17(11)13-12(16)14(18)15(13)19/h4,8H,1,5-7,16H2,2-3H3/b10-8+ |
| InChIKey | VFSOPTLXXUPDPI-CSKARUKUSA-N |
| XLogP | 1.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|