C11H16O2 — CID 143274841
(5E)-5-ethoxy-4-methylideneocta-5,7-dienal (PubChem CID 143274841) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (5E)-5-ethoxy-4-methylideneocta-5,7-dienal.
| Compound Name | (5E)-5-ethoxy-4-methylideneocta-5,7-dienal |
|---|---|
| PubChem CID | 143274841 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (5E)-5-ethoxy-4-methylideneocta-5,7-dienal |
| SMILES | C=C/C=C(/OCC)C(=C)CCC=O |
| InChI | InChI=1S/C11H16O2/c1-4-7-11(13-5-2)10(3)8-6-9-12/h4,7,9H,1,3,5-6,8H2,2H3/b11-7+ |
| InChIKey | GXHRGEMDXMUPTC-YRNVUSSQSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|