C25H42O2 — CID 144552285
ethane;(4E,6Z)-4-ethenyl-3-[(3Z,5E)-5-methoxyocta-1,3,5,7-tetraen-4-yl]octa-4,6-dienal (PubChem CID 144552285) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is ethane;(4E,6Z)-4-ethenyl-3-[(3Z,5E)-5-methoxyocta-1,3,5,7-tetraen-4-yl]octa-4,6-dienal.
| Compound Name | ethane;(4E,6Z)-4-ethenyl-3-[(3Z,5E)-5-methoxyocta-1,3,5,7-tetraen-4-yl]octa-4,6-dienal |
|---|---|
| PubChem CID | 144552285 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | ethane;(4E,6Z)-4-ethenyl-3-[(3Z,5E)-5-methoxyocta-1,3,5,7-tetraen-4-yl]octa-4,6-dienal |
| SMILES | C=C/C=C(C(=C/C=C)\OC)/C(CC=O)/C(C=C)=C/C=C\C.CC.CC.CC |
| InChI | InChI=1S/C19H24O2.3C2H6/c1-6-10-13-16(9-4)17(14-15-20)18(11-7-2)19(21-5)12-8-3;3*1-2/h6-13,15,17H,2-4,14H2,1,5H3;3*1-2H3/b10-6-,16-13+,18-11-,19-12+;;; |
| InChIKey | ADQWGNBTXZHQHD-NORBEMERSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|