About 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal
6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal (PubChem CID 89202893) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal.
Molecular Properties
| Compound Name | 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal |
| PubChem CID | 89202893 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal |
| SMILES | C=C(C)/C(=C\C)OCCCCCC=O |
| InChI | InChI=1S/C12H20O2/c1-4-12(11(2)3)14-10-8-6-5-7-9-13/h4,9H,2,5-8,10H2,1,3H3/b12-4+ |
| InChIKey | LOGSILVNMYKIOH-UUILKARUSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal?
The IUPAC name of 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal (CID 89202893) is 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal.
What is the SMILES notation for 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal?
The canonical SMILES for 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal is C=C(C)/C(=C\C)OCCCCCC=O.
What is the InChIKey of 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal?
The InChIKey is LOGSILVNMYKIOH-UUILKARUSA-N. The full InChI is InChI=1S/C12H20O2/c1-4-12(11(2)3)14-10-8-6-5-7-9-13/h4,9H,2,5-8,10H2,1,3H3/b12-4+.
What are the key properties of 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal?
6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal has a molecular weight of 196.29 g/mol, XLogP of 3.24, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3E)-2-methylpenta-1,3-dien-3-yl]oxyhexanal is sourced from PubChem (CID 89202893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).