C27H32F2N2O11 — CID 143276634
[(3S)-3-[(2-fluorophenyl)carbamoyloxy]-4-hydroxy-6-[(3S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxyoxan-2-yl]methyl N-(2-fluorophenyl)carbamate (PubChem CID 143276634) has the molecular formula C27H32F2N2O11 and a molecular weight of 598.55 g/mol. Its IUPAC name is [(3S)-3-[(2-fluorophenyl)carbamoyloxy]-4-hydroxy-6-[(3S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxyoxan-2-yl]methyl N-(2-fluorophenyl)carbamate.
| Compound Name | [(3S)-3-[(2-fluorophenyl)carbamoyloxy]-4-hydroxy-6-[(3S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxyoxan-2-yl]methyl N-(2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 143276634 |
| Molecular Formula | C27H32F2N2O11 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | [(3S)-3-[(2-fluorophenyl)carbamoyloxy]-4-hydroxy-6-[(3S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxyoxan-2-yl]methyl N-(2-fluorophenyl)carbamate |
| SMILES | COC1CC(O)[C@H](OC2CC(O)[C@H](OC(=O)Nc3ccccc3F)C(COC(=O)Nc3ccccc3F)O2)C(CO)O1 |
| InChI | InChI=1S/C27H32F2N2O11/c1-37-22-10-18(33)24(20(12-32)39-22)41-23-11-19(34)25(42-27(36)31-17-9-5-3-7-15(17)29)21(40-23)13-38-26(35)30-16-8-4-2-6-14(16)28/h2-9,18-25,32-34H,10-13H2,1H3,(H,30,35)(H,31,36)/t18?,19?,20?,21?,22?,23?,24-,25-/m0/s1 |
| InChIKey | GIIVSQTVIFDLBP-IWGFZSLYSA-N |
| XLogP | 2.11 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |