C26H45N3 — CID 143280029
2-ethyl-4-[(Z)-2-methylbut-2-enyl]-1-[1-[(3Z)-5-methyl-2-propan-2-ylidenehexa-3,5-dienyl]piperidin-4-yl]piperazine (PubChem CID 143280029) has the molecular formula C26H45N3 and a molecular weight of 399.67 g/mol. Its IUPAC name is 2-ethyl-4-[(Z)-2-methylbut-2-enyl]-1-[1-[(3Z)-5-methyl-2-propan-2-ylidenehexa-3,5-dienyl]piperidin-4-yl]piperazine.
| Compound Name | 2-ethyl-4-[(Z)-2-methylbut-2-enyl]-1-[1-[(3Z)-5-methyl-2-propan-2-ylidenehexa-3,5-dienyl]piperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 143280029 |
| Molecular Formula | C26H45N3 |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.36 |
| IUPAC Name | 2-ethyl-4-[(Z)-2-methylbut-2-enyl]-1-[1-[(3Z)-5-methyl-2-propan-2-ylidenehexa-3,5-dienyl]piperidin-4-yl]piperazine |
| SMILES | C=C(C)/C=C\C(CN1CCC(N2CCN(C/C(C)=C\C)CC2CC)CC1)=C(C)C |
| InChI | InChI=1S/C26H45N3/c1-8-23(7)18-28-16-17-29(25(9-2)20-28)26-12-14-27(15-13-26)19-24(22(5)6)11-10-21(3)4/h8,10-11,25-26H,3,9,12-20H2,1-2,4-7H3/b11-10-,23-8- |
| InChIKey | HKFWHSUFBORVRJ-HZBUNYOESA-N |
| XLogP | 5.28 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|