C18H25F4N — CID 143281159
5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine (PubChem CID 143281159) has the molecular formula C18H25F4N and a molecular weight of 331.40 g/mol. Its IUPAC name is 5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine.
| Compound Name | 5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 143281159 |
| Molecular Formula | C18H25F4N |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine |
| SMILES | CC/C=C(F)\C=C/CC1=C2CCN(CC(F)(F)F)CC2C(C)C1 |
| InChI | InChI=1S/C18H25F4N/c1-3-5-15(19)7-4-6-14-10-13(2)17-11-23(9-8-16(14)17)12-18(20,21)22/h4-5,7,13,17H,3,6,8-12H2,1-2H3/b7-4-,15-5+ |
| InChIKey | LJLFSRNWFOUKKL-LWNSUNLVSA-N |
| XLogP | 5.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|