C21H22F3N3OS — CID 143283685
[4-amino-2-(prop-2-enylamino)-1,3-thiazol-5-yl]-[3-(trifluoromethyl)phenyl]methanone;(E)-3-methylhex-3-en-1-yne (PubChem CID 143283685) has the molecular formula C21H22F3N3OS and a molecular weight of 421.49 g/mol. Its IUPAC name is [4-amino-2-(prop-2-enylamino)-1,3-thiazol-5-yl]-[3-(trifluoromethyl)phenyl]methanone;(E)-3-methylhex-3-en-1-yne.
| Compound Name | [4-amino-2-(prop-2-enylamino)-1,3-thiazol-5-yl]-[3-(trifluoromethyl)phenyl]methanone;(E)-3-methylhex-3-en-1-yne |
|---|---|
| PubChem CID | 143283685 |
| Molecular Formula | C21H22F3N3OS |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [4-amino-2-(prop-2-enylamino)-1,3-thiazol-5-yl]-[3-(trifluoromethyl)phenyl]methanone;(E)-3-methylhex-3-en-1-yne |
| SMILES | C#C/C(C)=C/CC.C=CCNc1nc(N)c(C(=O)c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H12F3N3OS.C7H10/c1-2-6-19-13-20-12(18)11(22-13)10(21)8-4-3-5-9(7-8)14(15,16)17;1-4-6-7(3)5-2/h2-5,7H,1,6,18H2,(H,19,20);2,6H,4H2,1,3H3/b;7-6+ |
| InChIKey | FGADJPGTBLWJOG-UETGHTDLSA-N |
| XLogP | 5.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|