C15H20N6OS — CID 143284375
[4-amino-1-[2-methyl-2-(methylsulfanylamino)propyl]imidazo[4,5-c][1,5]naphthyridin-2-yl]methanol (PubChem CID 143284375) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is [4-amino-1-[2-methyl-2-(methylsulfanylamino)propyl]imidazo[4,5-c][1,5]naphthyridin-2-yl]methanol.
| Compound Name | [4-amino-1-[2-methyl-2-(methylsulfanylamino)propyl]imidazo[4,5-c][1,5]naphthyridin-2-yl]methanol |
|---|---|
| PubChem CID | 143284375 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [4-amino-1-[2-methyl-2-(methylsulfanylamino)propyl]imidazo[4,5-c][1,5]naphthyridin-2-yl]methanol |
| SMILES | CSNC(C)(C)Cn1c(CO)nc2c(N)nc3cccnc3c21 |
| InChI | InChI=1S/C15H20N6OS/c1-15(2,20-23-3)8-21-10(7-22)19-12-13(21)11-9(18-14(12)16)5-4-6-17-11/h4-6,20,22H,7-8H2,1-3H3,(H2,16,18) |
| InChIKey | ZDXHLTZGSQNYSD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|