C19H24N6O2 — CID 91308676
1-[4-amino-2-[(cyclopenten-1-ylamino)oxymethyl]imidazo[4,5-c][1,5]naphthyridin-1-yl]-2-methylpropan-2-ol (PubChem CID 91308676) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[4-amino-2-[(cyclopenten-1-ylamino)oxymethyl]imidazo[4,5-c][1,5]naphthyridin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-amino-2-[(cyclopenten-1-ylamino)oxymethyl]imidazo[4,5-c][1,5]naphthyridin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 91308676 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[4-amino-2-[(cyclopenten-1-ylamino)oxymethyl]imidazo[4,5-c][1,5]naphthyridin-1-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cn1c(CONC2=CCCC2)nc2c(N)nc3cccnc3c21 |
| InChI | InChI=1S/C19H24N6O2/c1-19(2,26)11-25-14(10-27-24-12-6-3-4-7-12)23-16-17(25)15-13(22-18(16)20)8-5-9-21-15/h5-6,8-9,24,26H,3-4,7,10-11H2,1-2H3,(H2,20,22) |
| InChIKey | DNRLFDAFUNYODQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|