C17H26Cl2NO4PS — CID 143284500
7-[2-(3,5-dichlorophenoxy)ethyl-dimethylphosphanylsulfinylamino]heptanoic acid (PubChem CID 143284500) has the molecular formula C17H26Cl2NO4PS and a molecular weight of 442.35 g/mol. Its IUPAC name is 7-[2-(3,5-dichlorophenoxy)ethyl-dimethylphosphanylsulfinylamino]heptanoic acid.
| Compound Name | 7-[2-(3,5-dichlorophenoxy)ethyl-dimethylphosphanylsulfinylamino]heptanoic acid |
|---|---|
| PubChem CID | 143284500 |
| Molecular Formula | C17H26Cl2NO4PS |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 7-[2-(3,5-dichlorophenoxy)ethyl-dimethylphosphanylsulfinylamino]heptanoic acid |
| SMILES | CP(C)S(=O)N(CCCCCCC(=O)O)CCOc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H26Cl2NO4PS/c1-25(2)26(23)20(8-6-4-3-5-7-17(21)22)9-10-24-16-12-14(18)11-15(19)13-16/h11-13H,3-10H2,1-2H3,(H,21,22) |
| InChIKey | CBXRGSMXTFTISN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|