C17H23Cl2NO4S — CID 57180212
7-[3-(3,5-dichlorophenyl)prop-2-enyl-methylsulfonylamino]heptanoic acid (PubChem CID 57180212) has the molecular formula C17H23Cl2NO4S and a molecular weight of 408.35 g/mol. Its IUPAC name is 7-[3-(3,5-dichlorophenyl)prop-2-enyl-methylsulfonylamino]heptanoic acid.
| Compound Name | 7-[3-(3,5-dichlorophenyl)prop-2-enyl-methylsulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 57180212 |
| Molecular Formula | C17H23Cl2NO4S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 7-[3-(3,5-dichlorophenyl)prop-2-enyl-methylsulfonylamino]heptanoic acid |
| SMILES | CS(=O)(=O)N(CC=Cc1cc(Cl)cc(Cl)c1)CCCCCCC(=O)O |
| InChI | InChI=1S/C17H23Cl2NO4S/c1-25(23,24)20(9-5-3-2-4-8-17(21)22)10-6-7-14-11-15(18)13-16(19)12-14/h6-7,11-13H,2-5,8-10H2,1H3,(H,21,22) |
| InChIKey | MKRZVOZWCDRYBG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|