C26H35Cl2FN4O3 — CID 143284543
3-[(2Z,4Z)-1-chloro-2-fluorohexa-2,4-dien-3-yl]-4-(4-chloro-2-formamidophenyl)-1-methyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 143284543) has the molecular formula C26H35Cl2FN4O3 and a molecular weight of 541.50 g/mol. Its IUPAC name is 3-[(2Z,4Z)-1-chloro-2-fluorohexa-2,4-dien-3-yl]-4-(4-chloro-2-formamidophenyl)-1-methyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | 3-[(2Z,4Z)-1-chloro-2-fluorohexa-2,4-dien-3-yl]-4-(4-chloro-2-formamidophenyl)-1-methyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143284543 |
| Molecular Formula | C26H35Cl2FN4O3 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 3-[(2Z,4Z)-1-chloro-2-fluorohexa-2,4-dien-3-yl]-4-(4-chloro-2-formamidophenyl)-1-methyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | C/C=C\C(=C(\F)CCl)C1C(c2ccc(Cl)cc2NC=O)CN(C)C1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H35Cl2FN4O3/c1-3-5-20(22(29)15-27)24-21(19-7-6-18(28)14-23(19)31-17-34)16-32(2)25(24)26(35)30-8-4-9-33-10-12-36-13-11-33/h3,5-7,14,17,21,24-25H,4,8-13,15-16H2,1-2H3,(H,30,35)(H,31,34)/b5-3-,22-20- |
| InChIKey | KHKUQYYSQQNAHD-MRYYLKFUSA-N |
| XLogP | 3.80 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|